C11H13N3O5 — CID 107689376
N,N-bis(2-amino-2-oxoethyl)-2,6-dihydroxybenzamide (PubChem CID 107689376) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-2,6-dihydroxybenzamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107689376 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-2,6-dihydroxybenzamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C11H13N3O5/c12-8(17)4-14(5-9(13)18)11(19)10-6(15)2-1-3-7(10)16/h1-3,15-16H,4-5H2,(H2,12,17)(H2,13,18) |
| InChIKey | UOKVKAZNKLOIRV-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |