C12H17N3O4 — CID 107728907
N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3,4-dihydroxy-N-propylbenzamide (PubChem CID 107728907) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3,4-dihydroxy-N-propylbenzamide.
| Compound Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3,4-dihydroxy-N-propylbenzamide |
|---|---|
| PubChem CID | 107728907 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3,4-dihydroxy-N-propylbenzamide |
| SMILES | CCCN(C/C(N)=N/O)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-2-5-15(7-11(13)14-19)12(18)8-3-4-9(16)10(17)6-8/h3-4,6,16-17,19H,2,5,7H2,1H3,(H2,13,14) |
| InChIKey | RPPNLDDNWNHXBY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|