C12H13FN2O4S — CID 107434105
2-[(2-amino-2-oxoethyl)-[2-(4-fluorophenyl)sulfanylacetyl]amino]acetic acid (PubChem CID 107434105) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[2-(4-fluorophenyl)sulfanylacetyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[2-(4-fluorophenyl)sulfanylacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 107434105 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[2-(4-fluorophenyl)sulfanylacetyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O4S/c13-8-1-3-9(4-2-8)20-7-11(17)15(5-10(14)16)6-12(18)19/h1-4H,5-7H2,(H2,14,16)(H,18,19) |
| InChIKey | UMENRYKQWQIAJN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |