C13H15NO6S — CID 63651913
2-[carboxymethyl-[2-(4-methoxyphenyl)sulfanylacetyl]amino]acetic acid (PubChem CID 63651913) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(4-methoxyphenyl)sulfanylacetyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(4-methoxyphenyl)sulfanylacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 63651913 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[carboxymethyl-[2-(4-methoxyphenyl)sulfanylacetyl]amino]acetic acid |
| SMILES | COc1ccc(SCC(=O)N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO6S/c1-20-9-2-4-10(5-3-9)21-8-11(15)14(6-12(16)17)7-13(18)19/h2-5H,6-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QFHYFYQDUHTKQJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |