C22H20ClF3N2O3S — CID 10743496
N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(ethoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide (PubChem CID 10743496) has the molecular formula C22H20ClF3N2O3S and a molecular weight of 484.93 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(ethoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(ethoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10743496 |
| Molecular Formula | C22H20ClF3N2O3S |
| Molecular Weight | 484.93 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(ethoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide |
| SMILES | CCOCN(C(=O)Cc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)c1snc(C)c1Cl |
| InChI | InChI=1S/C22H20ClF3N2O3S/c1-3-30-13-28(21-20(23)14(2)27-32-21)19(29)12-15-4-8-17(9-5-15)31-18-10-6-16(7-11-18)22(24,25)26/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | ATGZANILPZJQFE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.93 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|