C21H18ClF3N2O3S — CID 10504572
N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(methoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide (PubChem CID 10504572) has the molecular formula C21H18ClF3N2O3S and a molecular weight of 470.90 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(methoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(methoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10504572 |
| Molecular Formula | C21H18ClF3N2O3S |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-N-(methoxymethyl)-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]acetamide |
| SMILES | COCN(C(=O)Cc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)c1snc(C)c1Cl |
| InChI | InChI=1S/C21H18ClF3N2O3S/c1-13-19(22)20(31-26-13)27(12-29-2)18(28)11-14-3-7-16(8-4-14)30-17-9-5-15(6-10-17)21(23,24)25/h3-10H,11-12H2,1-2H3 |
| InChIKey | CMVYTBLOMZTNCM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|