About [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate
[acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate (PubChem CID 10743527) has the molecular formula C20H23IO6
and a molecular weight of 486.30 g/mol. Its IUPAC name is [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate.
Molecular Properties
| Compound Name | [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate |
| PubChem CID | 10743527 |
| Molecular Formula | C20H23IO6 |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate |
| SMILES | CO[C@@H](C)c1cccc(OCc2ccccc2)c1I(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H23IO6/c1-14(24-4)18-11-8-12-19(25-13-17-9-6-5-7-10-17)20(18)21(26-15(2)22)27-16(3)23/h5-12,14H,13H2,1-4H3/t14-/m0/s1 |
| InChIKey | NUIKVCZCPUCCGI-AWEZNQCLSA-N |
| XLogP | 4.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate?
The IUPAC name of [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate (CID 10743527) is [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate.
What is the SMILES notation for [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate?
The canonical SMILES for [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate is CO[C@@H](C)c1cccc(OCc2ccccc2)c1I(OC(C)=O)OC(C)=O.
What is the InChIKey of [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate?
The InChIKey is NUIKVCZCPUCCGI-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H23IO6/c1-14(24-4)18-11-8-12-19(25-13-17-9-6-5-7-10-17)20(18)21(26-15(2)22)27-16(3)23/h5-12,14H,13H2,1-4H3/t14-/m0/s1.
What are the key properties of [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate?
[acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate has a molecular weight of 486.30 g/mol, XLogP of 4.61, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy-[2-[(1S)-1-methoxyethyl]-6-phenylmethoxyphenyl]-λ3-iodanyl] acetate is sourced from PubChem (CID 10743527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).