C10H16N4O5 — CID 107435545
5-amino-5-oxo-2-[(5-oxopiperazine-2-carbonyl)amino]pentanoic acid (PubChem CID 107435545) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-amino-5-oxo-2-[(5-oxopiperazine-2-carbonyl)amino]pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-[(5-oxopiperazine-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107435545 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-amino-5-oxo-2-[(5-oxopiperazine-2-carbonyl)amino]pentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C1CNC(=O)CN1)C(=O)O |
| InChI | InChI=1S/C10H16N4O5/c11-7(15)2-1-5(10(18)19)14-9(17)6-3-13-8(16)4-12-6/h5-6,12H,1-4H2,(H2,11,15)(H,13,16)(H,14,17)(H,18,19) |
| InChIKey | URYZBOOGFMRHHY-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |