C13H14N4O2S — CID 107436312
5-[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one (PubChem CID 107436312) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 5-[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one.
| Compound Name | 5-[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 107436312 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-[3-(phenylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
| SMILES | O=C1CNC(c2nc(CSc3ccccc3)no2)CN1 |
| InChI | InChI=1S/C13H14N4O2S/c18-12-7-14-10(6-15-12)13-16-11(17-19-13)8-20-9-4-2-1-3-5-9/h1-5,10,14H,6-8H2,(H,15,18) |
| InChIKey | KWNPQPDCNAGIPZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |