C9H14N4O3 — CID 107436079
5-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one (PubChem CID 107436079) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one.
| Compound Name | 5-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 107436079 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
| SMILES | COCCc1noc(C2CNC(=O)CN2)n1 |
| InChI | InChI=1S/C9H14N4O3/c1-15-3-2-7-12-9(16-13-7)6-4-11-8(14)5-10-6/h6,10H,2-5H2,1H3,(H,11,14) |
| InChIKey | UGNBIAGNLWCHJI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |