C10H14N4O3S — CID 107436486
5-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]piperazin-2-one (PubChem CID 107436486) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]piperazin-2-one.
| Compound Name | 5-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 107436486 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-[3-(1,4-oxathian-2-yl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
| SMILES | O=C1CNC(c2nc(C3CSCCO3)no2)CN1 |
| InChI | InChI=1S/C10H14N4O3S/c15-8-4-11-6(3-12-8)10-13-9(14-17-10)7-5-18-2-1-16-7/h6-7,11H,1-5H2,(H,12,15) |
| InChIKey | MTHKCPCHBPROKT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |