C11H10F3N3O4 — CID 107437408
2-[(2-amino-2-oxoethyl)-[(2,3,4-trifluorophenyl)carbamoyl]amino]acetic acid (PubChem CID 107437408) has the molecular formula C11H10F3N3O4 and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(2,3,4-trifluorophenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(2,3,4-trifluorophenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107437408 |
| Molecular Formula | C11H10F3N3O4 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(2,3,4-trifluorophenyl)carbamoyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H10F3N3O4/c12-5-1-2-6(10(14)9(5)13)16-11(21)17(3-7(15)18)4-8(19)20/h1-2H,3-4H2,(H2,15,18)(H,16,21)(H,19,20) |
| InChIKey | KQCTUIVVELWAJQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|