C12H14BrN3O4 — CID 107439128
2-[(2-amino-2-oxoethyl)-[(2-bromo-5-methylphenyl)carbamoyl]amino]acetic acid (PubChem CID 107439128) has the molecular formula C12H14BrN3O4 and a molecular weight of 344.17 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(2-bromo-5-methylphenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(2-bromo-5-methylphenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107439128 |
| Molecular Formula | C12H14BrN3O4 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(2-bromo-5-methylphenyl)carbamoyl]amino]acetic acid |
| SMILES | Cc1ccc(Br)c(NC(=O)N(CC(N)=O)CC(=O)O)c1 |
| InChI | InChI=1S/C12H14BrN3O4/c1-7-2-3-8(13)9(4-7)15-12(20)16(5-10(14)17)6-11(18)19/h2-4H,5-6H2,1H3,(H2,14,17)(H,15,20)(H,18,19) |
| InChIKey | ZKNGJOAITZSPLO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |