C10H14N2O3 — CID 107439682
5-oxo-1-pent-4-ynylpiperazine-2-carboxylic acid (PubChem CID 107439682) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-oxo-1-pent-4-ynylpiperazine-2-carboxylic acid.
| Compound Name | 5-oxo-1-pent-4-ynylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107439682 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-oxo-1-pent-4-ynylpiperazine-2-carboxylic acid |
| SMILES | C#CCCCN1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C10H14N2O3/c1-2-3-4-5-12-7-9(13)11-6-8(12)10(14)15/h1,8H,3-7H2,(H,11,13)(H,14,15) |
| InChIKey | ODHZFPMOOMCWIJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|