C9H16N2O4 — CID 107439843
1-(2-ethoxyethyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107439843) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(2-ethoxyethyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107439843 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | CCOCCN1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c1-2-15-4-3-11-6-8(12)10-5-7(11)9(13)14/h7H,2-6H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | PATRWGKRKKSTJJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|