About 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid
5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid (PubChem CID 107439882) has the molecular formula C11H16N4O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid |
| PubChem CID | 107439882 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid |
| SMILES | CCCc1noc(CN2CC(=O)NCC2C(=O)O)n1 |
| InChI | InChI=1S/C11H16N4O4/c1-2-3-8-13-10(19-14-8)6-15-5-9(16)12-4-7(15)11(17)18/h7H,2-6H2,1H3,(H,12,16)(H,17,18) |
| InChIKey | VYVDRPJPTWMZEJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid?
The IUPAC name of 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid (CID 107439882) is 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid.
What is the SMILES notation for 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid?
The canonical SMILES for 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid is CCCc1noc(CN2CC(=O)NCC2C(=O)O)n1.
What is the InChIKey of 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid?
The InChIKey is VYVDRPJPTWMZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O4/c1-2-3-8-13-10(19-14-8)6-15-5-9(16)12-4-7(15)11(17)18/h7H,2-6H2,1H3,(H,12,16)(H,17,18).
What are the key properties of 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid?
5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid has a molecular weight of 268.27 g/mol, XLogP of -0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]piperazine-2-carboxylic acid is sourced from PubChem (CID 107439882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).