C14H22N4O2 — CID 107441237
5-[[2-(aminomethyl)-3-methylbutyl]amino]benzene-1,3-dicarboxamide (PubChem CID 107441237) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-[[2-(aminomethyl)-3-methylbutyl]amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[2-(aminomethyl)-3-methylbutyl]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 107441237 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5-[[2-(aminomethyl)-3-methylbutyl]amino]benzene-1,3-dicarboxamide |
| SMILES | CC(C)C(CN)CNc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C14H22N4O2/c1-8(2)11(6-15)7-18-12-4-9(13(16)19)3-10(5-12)14(17)20/h3-5,8,11,18H,6-7,15H2,1-2H3,(H2,16,19)(H2,17,20) |
| InChIKey | SRNPXWSDNCVOMC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |