C11H16N4O2 — CID 103387595
5-(1-aminopropan-2-ylamino)benzene-1,3-dicarboxamide (PubChem CID 103387595) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 5-(1-aminopropan-2-ylamino)benzene-1,3-dicarboxamide.
| Compound Name | 5-(1-aminopropan-2-ylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 103387595 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-(1-aminopropan-2-ylamino)benzene-1,3-dicarboxamide |
| SMILES | CC(CN)Nc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C11H16N4O2/c1-6(5-12)15-9-3-7(10(13)16)2-8(4-9)11(14)17/h2-4,6,15H,5,12H2,1H3,(H2,13,16)(H2,14,17) |
| InChIKey | FHMQRCLDSGQFOQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |