C16H34N2O2S — CID 107442740
tert-butyl N-[3-methyl-2-[(4-methylsulfanylbutan-2-ylamino)methyl]butyl]carbamate (PubChem CID 107442740) has the molecular formula C16H34N2O2S and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[(4-methylsulfanylbutan-2-ylamino)methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[(4-methylsulfanylbutan-2-ylamino)methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107442740 |
| Molecular Formula | C16H34N2O2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[(4-methylsulfanylbutan-2-ylamino)methyl]butyl]carbamate |
| SMILES | CSCCC(C)NCC(CNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H34N2O2S/c1-12(2)14(10-17-13(3)8-9-21-7)11-18-15(19)20-16(4,5)6/h12-14,17H,8-11H2,1-7H3,(H,18,19) |
| InChIKey | AYAXTXMPBLKRTN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |