C14H29N3O3 — CID 107443031
tert-butyl N-[4-amino-3-(ethylamino)-4-oxo-2-propan-2-ylbutyl]carbamate (PubChem CID 107443031) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(ethylamino)-4-oxo-2-propan-2-ylbutyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(ethylamino)-4-oxo-2-propan-2-ylbutyl]carbamate |
|---|---|
| PubChem CID | 107443031 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | tert-butyl N-[4-amino-3-(ethylamino)-4-oxo-2-propan-2-ylbutyl]carbamate |
| SMILES | CCNC(C(N)=O)C(CNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H29N3O3/c1-7-16-11(12(15)18)10(9(2)3)8-17-13(19)20-14(4,5)6/h9-11,16H,7-8H2,1-6H3,(H2,15,18)(H,17,19) |
| InChIKey | SDHYJZSVPOXAHX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |