C14H33N3 — CID 107445286
2-N-[2-(tert-butylamino)ethyl]-1-N,1-N,4-trimethylpentane-1,2-diamine (PubChem CID 107445286) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is 2-N-[2-(tert-butylamino)ethyl]-1-N,1-N,4-trimethylpentane-1,2-diamine.
| Compound Name | 2-N-[2-(tert-butylamino)ethyl]-1-N,1-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 107445286 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | 2-N-[2-(tert-butylamino)ethyl]-1-N,1-N,4-trimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN(C)C)NCCNC(C)(C)C |
| InChI | InChI=1S/C14H33N3/c1-12(2)10-13(11-17(6)7)15-8-9-16-14(3,4)5/h12-13,15-16H,8-11H2,1-7H3 |
| InChIKey | LKPXLARJIUUECX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|