C13H28N2O2 — CID 103244197
5-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pentanoic acid (PubChem CID 103244197) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pentanoic acid.
| Compound Name | 5-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 103244197 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 5-[[1-(dimethylamino)-4-methylpentan-2-yl]amino]pentanoic acid |
| SMILES | CC(C)CC(CN(C)C)NCCCCC(=O)O |
| InChI | InChI=1S/C13H28N2O2/c1-11(2)9-12(10-15(3)4)14-8-6-5-7-13(16)17/h11-12,14H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | VYILSFGUYJMJQR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|