C15H20FN3 — CID 107446960
N-[[3-(2-fluoro-4-methylphenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107446960) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is N-[[3-(2-fluoro-4-methylphenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-(2-fluoro-4-methylphenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107446960 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-[[3-(2-fluoro-4-methylphenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1ccc(-n2cncc2CNC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C15H20FN3/c1-11-5-6-14(13(16)7-11)19-10-17-8-12(19)9-18-15(2,3)4/h5-8,10,18H,9H2,1-4H3 |
| InChIKey | CXLDKNFFLIYVSM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |