C14H17ClIN3 — CID 107608528
N-[[3-(2-chloro-4-iodophenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107608528) has the molecular formula C14H17ClIN3 and a molecular weight of 389.67 g/mol. Its IUPAC name is N-[[3-(2-chloro-4-iodophenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-(2-chloro-4-iodophenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107608528 |
| Molecular Formula | C14H17ClIN3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | N-[[3-(2-chloro-4-iodophenyl)imidazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cncn1-c1ccc(I)cc1Cl |
| InChI | InChI=1S/C14H17ClIN3/c1-14(2,3)18-8-11-7-17-9-19(11)13-5-4-10(16)6-12(13)15/h4-7,9,18H,8H2,1-3H3 |
| InChIKey | JAAORZBQZGBORN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|