About (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine
(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine (PubChem CID 107447516) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine |
| PubChem CID | 107447516 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine |
| SMILES | NCc1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C7H8N6/c8-4-6-11-5-12-13(6)7-9-2-1-3-10-7/h1-3,5H,4,8H2 |
| InChIKey | JXCGKOAEQOHFMV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine?
The IUPAC name of (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine (CID 107447516) is (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine.
What is the SMILES notation for (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine?
The canonical SMILES for (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine is NCc1ncnn1-c1ncccn1.
What is the InChIKey of (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine?
The InChIKey is JXCGKOAEQOHFMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6/c8-4-6-11-5-12-13(6)7-9-2-1-3-10-7/h1-3,5H,4,8H2.
What are the key properties of (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine?
(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine has a molecular weight of 176.18 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrimidin-2-yl-1,2,4-triazol-3-yl)methanamine is sourced from PubChem (CID 107447516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).