C16H32N2O2 — CID 107449379
1-[2-(diethylamino)ethylamino]-3-propan-2-ylcyclohexane-1-carboxylic acid (PubChem CID 107449379) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethylamino]-3-propan-2-ylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-(diethylamino)ethylamino]-3-propan-2-ylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107449379 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1-[2-(diethylamino)ethylamino]-3-propan-2-ylcyclohexane-1-carboxylic acid |
| SMILES | CCN(CC)CCNC1(C(=O)O)CCCC(C(C)C)C1 |
| InChI | InChI=1S/C16H32N2O2/c1-5-18(6-2)11-10-17-16(15(19)20)9-7-8-14(12-16)13(3)4/h13-14,17H,5-12H2,1-4H3,(H,19,20) |
| InChIKey | FLSWTABKEMANMD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |