C12H10F3N5 — CID 107451687
4-[5-(methylaminomethyl)triazol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 107451687) has the molecular formula C12H10F3N5 and a molecular weight of 281.24 g/mol. Its IUPAC name is 4-[5-(methylaminomethyl)triazol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-(methylaminomethyl)triazol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 107451687 |
| Molecular Formula | C12H10F3N5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[5-(methylaminomethyl)triazol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CNCc1cnnn1-c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N5/c1-17-6-10-7-18-19-20(10)9-3-2-8(5-16)11(4-9)12(13,14)15/h2-4,7,17H,6H2,1H3 |
| InChIKey | QYMCTJYNVONWJD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |