C14H13F3N6O — CID 66656244
4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 66656244) has the molecular formula C14H13F3N6O and a molecular weight of 338.29 g/mol. Its IUPAC name is 4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 66656244 |
| Molecular Formula | C14H13F3N6O |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(-n2nnnc2CN2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N6O/c15-14(16,17)12-7-11(2-1-10(12)8-18)23-13(19-20-21-23)9-22-3-5-24-6-4-22/h1-2,7H,3-6,9H2 |
| InChIKey | OJDOLNVGXOUMDZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |