C17H27BrN2S — CID 107453294
1-(3-bromophenyl)-1-(7,7-dimethyl-1,4-thiazepan-4-yl)butan-2-amine (PubChem CID 107453294) has the molecular formula C17H27BrN2S and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-(3-bromophenyl)-1-(7,7-dimethyl-1,4-thiazepan-4-yl)butan-2-amine.
| Compound Name | 1-(3-bromophenyl)-1-(7,7-dimethyl-1,4-thiazepan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 107453294 |
| Molecular Formula | C17H27BrN2S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-(3-bromophenyl)-1-(7,7-dimethyl-1,4-thiazepan-4-yl)butan-2-amine |
| SMILES | CCC(N)C(c1cccc(Br)c1)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C17H27BrN2S/c1-4-15(19)16(13-6-5-7-14(18)12-13)20-9-8-17(2,3)21-11-10-20/h5-7,12,15-16H,4,8-11,19H2,1-3H3 |
| InChIKey | UMPRKMKGZDXQGH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |