C27H30BN7O6 — CID 10745427
(2S)-5-(3-boronoanilino)-2-[[4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 10745427) has the molecular formula C27H30BN7O6 and a molecular weight of 559.39 g/mol. Its IUPAC name is (2S)-5-(3-boronoanilino)-2-[[4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-(3-boronoanilino)-2-[[4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10745427 |
| Molecular Formula | C27H30BN7O6 |
| Molecular Weight | 559.39 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | (2S)-5-(3-boronoanilino)-2-[[4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | Nc1nc(N)c2c(CCCc3ccc(C(=O)N[C@@H](CCC(=O)Nc4cccc(B(O)O)c4)C(=O)O)cc3)c[nH]c2n1 |
| InChI | InChI=1S/C27H30BN7O6/c29-23-22-17(14-31-24(22)35-27(30)34-23)4-1-3-15-7-9-16(10-8-15)25(37)33-20(26(38)39)11-12-21(36)32-19-6-2-5-18(13-19)28(40)41/h2,5-10,13-14,20,40-41H,1,3-4,11-12H2,(H,32,36)(H,33,37)(H,38,39)(H5,29,30,31,34,35)/t20-/m0/s1 |
| InChIKey | GKWHOAVEJSYHGH-FQEVSTJZSA-N |
| XLogP | 0.58 |
| TPSA | 229.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|