C24H26N6O5 — CID 54117554
(2S)-2-[[4-[1-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)hex-5-yn-3-yl]benzoyl]amino]pentanedioic acid (PubChem CID 54117554) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is (2S)-2-[[4-[1-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)hex-5-yn-3-yl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[1-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)hex-5-yn-3-yl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 54117554 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2S)-2-[[4-[1-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)hex-5-yn-3-yl]benzoyl]amino]pentanedioic acid |
| SMILES | C#CCC(CCc1c[nH]c2nc(N)nc(N)c12)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C24H26N6O5/c1-2-3-13(6-9-16-12-27-21-19(16)20(25)29-24(26)30-21)14-4-7-15(8-5-14)22(33)28-17(23(34)35)10-11-18(31)32/h1,4-5,7-8,12-13,17H,3,6,9-11H2,(H,28,33)(H,31,32)(H,34,35)(H5,25,26,27,29,30)/t13?,17-/m0/s1 |
| InChIKey | NLKDBHFODDEDPK-RUINGEJQSA-N |
| XLogP | 1.91 |
| TPSA | 197.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|