C20H24N6O5S — CID 18655442
(2S)-2-[[5-[4-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)butyl]thiophene-2-carbonyl]amino]pentanedioic acid (PubChem CID 18655442) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is (2S)-2-[[5-[4-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)butyl]thiophene-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[5-[4-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)butyl]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18655442 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (2S)-2-[[5-[4-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)butyl]thiophene-2-carbonyl]amino]pentanedioic acid |
| SMILES | Nc1nc(N)c2c(CCCCc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)s3)c[nH]c2n1 |
| InChI | InChI=1S/C20H24N6O5S/c21-16-15-10(9-23-17(15)26-20(22)25-16)3-1-2-4-11-5-7-13(32-11)18(29)24-12(19(30)31)6-8-14(27)28/h5,7,9,12H,1-4,6,8H2,(H,24,29)(H,27,28)(H,30,31)(H5,21,22,23,25,26)/t12-/m0/s1 |
| InChIKey | HEUBDUFRSKCUJB-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 197.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|