C22H26N4O6S2 — CID 24770898
(2R)-2-[[5-[6-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)hexyl]thiophene-2-carbonyl]amino]pentanedioic acid (PubChem CID 24770898) has the molecular formula C22H26N4O6S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2R)-2-[[5-[6-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)hexyl]thiophene-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[5-[6-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)hexyl]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 24770898 |
| Molecular Formula | C22H26N4O6S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (2R)-2-[[5-[6-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)hexyl]thiophene-2-carbonyl]amino]pentanedioic acid |
| SMILES | Nc1nc2sc(CCCCCCc3ccc(C(=O)N[C@H](CCC(=O)O)C(=O)O)s3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H26N4O6S2/c23-22-25-18(29)14-11-13(34-20(14)26-22)6-4-2-1-3-5-12-7-9-16(33-12)19(30)24-15(21(31)32)8-10-17(27)28/h7,9,11,15H,1-6,8,10H2,(H,24,30)(H,27,28)(H,31,32)(H3,23,25,26,29)/t15-/m1/s1 |
| InChIKey | FSLMIDNNJSTXKD-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 175.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|