C37H39NO4 — CID 10745474
methyl 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylate (PubChem CID 10745474) has the molecular formula C37H39NO4 and a molecular weight of 561.72 g/mol. Its IUPAC name is methyl 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylate.
| Compound Name | methyl 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylate |
|---|---|
| PubChem CID | 10745474 |
| Molecular Formula | C37H39NO4 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | methyl 15,17-dioxo-16-tridecan-7-yl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylate |
| SMILES | CCCCCCC(CCCCCC)N1C(=O)c2ccc3c4cccc5c(C(=O)OC)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C37H39NO4/c1-4-6-8-10-13-23(14-11-9-7-5-2)38-35(39)30-21-18-27-24-15-12-16-25-29(37(41)42-3)20-17-26(32(24)25)28-19-22-31(36(38)40)34(30)33(27)28/h12,15-23H,4-11,13-14H2,1-3H3 |
| InChIKey | WSWASZPLXAONSW-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|