C32H36INO2 — CID 71579704
[2-[5-(4-tert-butylphenyl)naphthalen-2-yl]-5-methoxycarbonylphenyl]methyl-trimethylazanium iodide (PubChem CID 71579704) has the molecular formula C32H36INO2 and a molecular weight of 593.55 g/mol. Its IUPAC name is [2-[5-(4-tert-butylphenyl)naphthalen-2-yl]-5-methoxycarbonylphenyl]methyl-trimethylazanium iodide.
| Compound Name | [2-[5-(4-tert-butylphenyl)naphthalen-2-yl]-5-methoxycarbonylphenyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 71579704 |
| Molecular Formula | C32H36INO2 |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | [2-[5-(4-tert-butylphenyl)naphthalen-2-yl]-5-methoxycarbonylphenyl]methyl-trimethylazanium iodide |
| SMILES | COC(=O)c1ccc(-c2ccc3c(-c4ccc(C(C)(C)C)cc4)cccc3c2)c(C[N+](C)(C)C)c1.[I-] |
| InChI | InChI=1S/C32H36NO2.HI/c1-32(2,3)27-15-11-22(12-16-27)29-10-8-9-23-19-24(13-18-30(23)29)28-17-14-25(31(34)35-7)20-26(28)21-33(4,5)6;/h8-20H,21H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | FTLRNECWLLOPFJ-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|