C32H30N4O6 — CID 10745561
(2R)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 10745561) has the molecular formula C32H30N4O6 and a molecular weight of 566.61 g/mol. Its IUPAC name is (2R)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10745561 |
| Molecular Formula | C32H30N4O6 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (2R)-2-[[(2R,5R,11bS)-3-oxo-2-(phenylmethoxycarbonylamino)-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@@H]1C[C@H]2c3[nH]c4ccccc4c3C[C@H](C(=O)N[C@H](Cc3ccccc3)C(=O)O)N2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H30N4O6/c37-29(34-25(31(39)40)15-19-9-3-1-4-10-19)27-16-22-21-13-7-8-14-23(21)33-28(22)26-17-24(30(38)36(26)27)35-32(41)42-18-20-11-5-2-6-12-20/h1-14,24-27,33H,15-18H2,(H,34,37)(H,35,41)(H,39,40)/t24-,25-,26+,27-/m1/s1 |
| InChIKey | FORCEXNNBSDSEI-JVYGEBFASA-N |
| XLogP | 3.47 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|