C16H26N2S — CID 107455784
1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)phenyl]-N-methylethanamine (PubChem CID 107455784) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)phenyl]-N-methylethanamine.
| Compound Name | 1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 107455784 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(N2CCSC(C)(C)CC2)cc1 |
| InChI | InChI=1S/C16H26N2S/c1-13(17-4)14-5-7-15(8-6-14)18-10-9-16(2,3)19-12-11-18/h5-8,13,17H,9-12H2,1-4H3 |
| InChIKey | FQAAGFNOHGOMIJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|