C11H11FN4O2S — CID 107459054
4-fluoro-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzohydrazide (PubChem CID 107459054) has the molecular formula C11H11FN4O2S and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-fluoro-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzohydrazide.
| Compound Name | 4-fluoro-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzohydrazide |
|---|---|
| PubChem CID | 107459054 |
| Molecular Formula | C11H11FN4O2S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-fluoro-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzohydrazide |
| SMILES | Cc1nnc(SCc2cc(C(=O)NN)ccc2F)o1 |
| InChI | InChI=1S/C11H11FN4O2S/c1-6-15-16-11(18-6)19-5-8-4-7(10(17)14-13)2-3-9(8)12/h2-4H,5,13H2,1H3,(H,14,17) |
| InChIKey | YMPKNVJGYXPRNO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|