C15H16FN3OS — CID 107459216
3-[(2-amino-3-methylphenyl)sulfanylmethyl]-4-fluorobenzohydrazide (PubChem CID 107459216) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[(2-amino-3-methylphenyl)sulfanylmethyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[(2-amino-3-methylphenyl)sulfanylmethyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107459216 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-[(2-amino-3-methylphenyl)sulfanylmethyl]-4-fluorobenzohydrazide |
| SMILES | Cc1cccc(SCc2cc(C(=O)NN)ccc2F)c1N |
| InChI | InChI=1S/C15H16FN3OS/c1-9-3-2-4-13(14(9)17)21-8-11-7-10(15(20)19-18)5-6-12(11)16/h2-7H,8,17-18H2,1H3,(H,19,20) |
| InChIKey | BHBITHIIMNMZQH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|