C14H28N2OS — CID 107460087
3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)propyl]morpholine (PubChem CID 107460087) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)propyl]morpholine.
| Compound Name | 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)propyl]morpholine |
|---|---|
| PubChem CID | 107460087 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)propyl]morpholine |
| SMILES | CC(CC1COCCN1)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C14H28N2OS/c1-12(10-13-11-17-8-5-15-13)16-6-4-14(2,3)18-9-7-16/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | DXDHRAJXDIZJAI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |