C12H24N2S — CID 107455301
7,7-dimethyl-4-(pyrrolidin-2-ylmethyl)-1,4-thiazepane (PubChem CID 107455301) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 7,7-dimethyl-4-(pyrrolidin-2-ylmethyl)-1,4-thiazepane.
| Compound Name | 7,7-dimethyl-4-(pyrrolidin-2-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 107455301 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 7,7-dimethyl-4-(pyrrolidin-2-ylmethyl)-1,4-thiazepane |
| SMILES | CC1(C)CCN(CC2CCCN2)CCS1 |
| InChI | InChI=1S/C12H24N2S/c1-12(2)5-7-14(8-9-15-12)10-11-4-3-6-13-11/h11,13H,3-10H2,1-2H3 |
| InChIKey | HTPKXOAHBOFCQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |