C14H28N2O2S2 — CID 107456569
7,7-dimethyl-4-(2-piperidin-2-ylethylsulfonyl)-1,4-thiazepane (PubChem CID 107456569) has the molecular formula C14H28N2O2S2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 7,7-dimethyl-4-(2-piperidin-2-ylethylsulfonyl)-1,4-thiazepane.
| Compound Name | 7,7-dimethyl-4-(2-piperidin-2-ylethylsulfonyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 107456569 |
| Molecular Formula | C14H28N2O2S2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 7,7-dimethyl-4-(2-piperidin-2-ylethylsulfonyl)-1,4-thiazepane |
| SMILES | CC1(C)CCN(S(=O)(=O)CCC2CCCCN2)CCS1 |
| InChI | InChI=1S/C14H28N2O2S2/c1-14(2)7-9-16(10-11-19-14)20(17,18)12-6-13-5-3-4-8-15-13/h13,15H,3-12H2,1-2H3 |
| InChIKey | NILHYNBPYMTDDG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |