C14H30N2O2S2 — CID 107460039
4-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-N-propylbutan-1-amine (PubChem CID 107460039) has the molecular formula C14H30N2O2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-N-propylbutan-1-amine.
| Compound Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107460039 |
| Molecular Formula | C14H30N2O2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]-N-propylbutan-1-amine |
| SMILES | CCCNCCCCS(=O)(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C14H30N2O2S2/c1-4-8-15-9-5-6-13-20(17,18)16-10-7-14(2,3)19-12-11-16/h15H,4-13H2,1-3H3 |
| InChIKey | ASUUOSUVAGWRMM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|