C11H20N2O2S2 — CID 107271352
2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]butanenitrile (PubChem CID 107271352) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]butanenitrile.
| Compound Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]butanenitrile |
|---|---|
| PubChem CID | 107271352 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]butanenitrile |
| SMILES | CCC(C#N)S(=O)(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-4-10(9-12)17(14,15)13-6-5-11(2,3)16-8-7-13/h10H,4-8H2,1-3H3 |
| InChIKey | MJHLRURREZFTBJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |