C11H22ClNO2S2 — CID 107458005
4-(3-chloro-2-methylpropyl)sulfonyl-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458005) has the molecular formula C11H22ClNO2S2 and a molecular weight of 299.89 g/mol. Its IUPAC name is 4-(3-chloro-2-methylpropyl)sulfonyl-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-(3-chloro-2-methylpropyl)sulfonyl-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107458005 |
| Molecular Formula | C11H22ClNO2S2 |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(3-chloro-2-methylpropyl)sulfonyl-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC(CCl)CS(=O)(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C11H22ClNO2S2/c1-10(8-12)9-17(14,15)13-5-4-11(2,3)16-7-6-13/h10H,4-9H2,1-3H3 |
| InChIKey | DINVPUYXBOGBKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|