C10H21NO3S2 — CID 107459915
2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]propan-1-ol (PubChem CID 107459915) has the molecular formula C10H21NO3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]propan-1-ol.
| Compound Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]propan-1-ol |
|---|---|
| PubChem CID | 107459915 |
| Molecular Formula | C10H21NO3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-[(7,7-dimethyl-1,4-thiazepan-4-yl)sulfonyl]propan-1-ol |
| SMILES | CC(CO)S(=O)(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C10H21NO3S2/c1-9(8-12)16(13,14)11-5-4-10(2,3)15-7-6-11/h9,12H,4-8H2,1-3H3 |
| InChIKey | GCKNQCQNNLFPSC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |