C13H28N2O3S — CID 102746509
N-[2-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylethyl]propan-1-amine (PubChem CID 102746509) has the molecular formula C13H28N2O3S and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[2-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylethyl]propan-1-amine.
| Compound Name | N-[2-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylethyl]propan-1-amine |
|---|---|
| PubChem CID | 102746509 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[2-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylethyl]propan-1-amine |
| SMILES | CCCNCCS(=O)(=O)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C13H28N2O3S/c1-6-7-14-8-9-19(16,17)15-10-12(2,3)18-13(4,5)11-15/h14H,6-11H2,1-5H3 |
| InChIKey | QLRPWIKMVBRVER-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|