C14H30N2O3S — CID 102744605
N-propan-2-yl-3-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylpropan-1-amine (PubChem CID 102744605) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is N-propan-2-yl-3-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylpropan-1-amine.
| Compound Name | N-propan-2-yl-3-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylpropan-1-amine |
|---|---|
| PubChem CID | 102744605 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | N-propan-2-yl-3-(2,2,6,6-tetramethylmorpholin-4-yl)sulfonylpropan-1-amine |
| SMILES | CC(C)NCCCS(=O)(=O)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O3S/c1-12(2)15-8-7-9-20(17,18)16-10-13(3,4)19-14(5,6)11-16/h12,15H,7-11H2,1-6H3 |
| InChIKey | HDYIOYLPUFAUFC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|