C13H26N2S — CID 107455308
7,7-dimethyl-4-(piperidin-2-ylmethyl)-1,4-thiazepane (PubChem CID 107455308) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is 7,7-dimethyl-4-(piperidin-2-ylmethyl)-1,4-thiazepane.
| Compound Name | 7,7-dimethyl-4-(piperidin-2-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 107455308 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 7,7-dimethyl-4-(piperidin-2-ylmethyl)-1,4-thiazepane |
| SMILES | CC1(C)CCN(CC2CCCCN2)CCS1 |
| InChI | InChI=1S/C13H26N2S/c1-13(2)6-8-15(9-10-16-13)11-12-5-3-4-7-14-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | FYHIAGKBYXBMPE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |