C7H9F2N3O2 — CID 107460735
3-[1-(2,2-difluoroethyl)triazol-4-yl]propanoic acid (PubChem CID 107460735) has the molecular formula C7H9F2N3O2 and a molecular weight of 205.16 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroethyl)triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(2,2-difluoroethyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107460735 |
| Molecular Formula | C7H9F2N3O2 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-[1-(2,2-difluoroethyl)triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(CC(F)F)nn1 |
| InChI | InChI=1S/C7H9F2N3O2/c8-6(9)4-12-3-5(10-11-12)1-2-7(13)14/h3,6H,1-2,4H2,(H,13,14) |
| InChIKey | GUULNCINWCMRDG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |